C18H9Cl2N3O2 — CID 102288339
17,18-dichloro-7-methyl-4-oxa-12,14,21-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3(8),6,9,13,15,17,19-nonaen-5-one (PubChem CID 102288339) has the molecular formula C18H9Cl2N3O2 and a molecular weight of 370.20 g/mol. Its IUPAC name is 17,18-dichloro-7-methyl-4-oxa-12,14,21-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3(8),6,9,13,15,17,19-nonaen-5-one.
| Compound Name | 17,18-dichloro-7-methyl-4-oxa-12,14,21-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3(8),6,9,13,15,17,19-nonaen-5-one |
|---|---|
| PubChem CID | 102288339 |
| Molecular Formula | C18H9Cl2N3O2 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 17,18-dichloro-7-methyl-4-oxa-12,14,21-triazapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3(8),6,9,13,15,17,19-nonaen-5-one |
| SMILES | Cc1cc(=O)oc2c1ccc1[nH]c3nc4cc(Cl)c(Cl)cc4nc3c12 |
| InChI | InChI=1S/C18H9Cl2N3O2/c1-7-4-14(24)25-17-8(7)2-3-11-15(17)16-18(22-11)23-13-6-10(20)9(19)5-12(13)21-16/h2-6H,1H3,(H,22,23) |
| InChIKey | ANYTWIVXVXNMDK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|