C13H11NO3 — CID 131858865
9-amino-4,8-dimethylfuro[2,3-h]chromen-2-one (PubChem CID 131858865) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 9-amino-4,8-dimethylfuro[2,3-h]chromen-2-one.
| Compound Name | 9-amino-4,8-dimethylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 131858865 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 9-amino-4,8-dimethylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1oc2ccc3c(C)cc(=O)oc3c2c1N |
| InChI | InChI=1S/C13H11NO3/c1-6-5-10(15)17-13-8(6)3-4-9-11(13)12(14)7(2)16-9/h3-5H,14H2,1-2H3 |
| InChIKey | WYNOMXZWPHJFJK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|