C19H11NO4 — CID 11666843
18-methyl-7,15-dioxa-12-azapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3(8),4,9,14(19),17,20-octaene-6,16-dione (PubChem CID 11666843) has the molecular formula C19H11NO4 and a molecular weight of 317.30 g/mol. Its IUPAC name is 18-methyl-7,15-dioxa-12-azapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3(8),4,9,14(19),17,20-octaene-6,16-dione.
| Compound Name | 18-methyl-7,15-dioxa-12-azapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3(8),4,9,14(19),17,20-octaene-6,16-dione |
|---|---|
| PubChem CID | 11666843 |
| Molecular Formula | C19H11NO4 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 18-methyl-7,15-dioxa-12-azapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3(8),4,9,14(19),17,20-octaene-6,16-dione |
| SMILES | Cc1cc(=O)oc2c1ccc1c2[nH]c2ccc3oc(=O)ccc3c21 |
| InChI | InChI=1S/C19H11NO4/c1-9-8-16(22)24-19-10(9)2-3-12-17-11-4-7-15(21)23-14(11)6-5-13(17)20-18(12)19/h2-8,20H,1H3 |
| InChIKey | GWBZWKILHPVORG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|