About 4,6-dimethylchromen-2-one;molecular hydrogen
4,6-dimethylchromen-2-one;molecular hydrogen (PubChem CID 143310046) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 4,6-dimethylchromen-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 4,6-dimethylchromen-2-one;molecular hydrogen |
| PubChem CID | 143310046 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4,6-dimethylchromen-2-one;molecular hydrogen |
| SMILES | Cc1ccc2oc(=O)cc(C)c2c1.[H][H] |
| InChI | InChI=1S/C11H10O2.H2/c1-7-3-4-10-9(5-7)8(2)6-11(12)13-10;/h3-6H,1-2H3;1H |
| InChIKey | ITAOAXGSKLPNSH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethylchromen-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethylchromen-2-one;molecular hydrogen?
The IUPAC name of 4,6-dimethylchromen-2-one;molecular hydrogen (CID 143310046) is 4,6-dimethylchromen-2-one;molecular hydrogen.
What is the SMILES notation for 4,6-dimethylchromen-2-one;molecular hydrogen?
The canonical SMILES for 4,6-dimethylchromen-2-one;molecular hydrogen is Cc1ccc2oc(=O)cc(C)c2c1.[H][H].
What is the InChIKey of 4,6-dimethylchromen-2-one;molecular hydrogen?
The InChIKey is ITAOAXGSKLPNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.H2/c1-7-3-4-10-9(5-7)8(2)6-11(12)13-10;/h3-6H,1-2H3;1H.
What are the key properties of 4,6-dimethylchromen-2-one;molecular hydrogen?
4,6-dimethylchromen-2-one;molecular hydrogen has a molecular weight of 176.21 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethylchromen-2-one;molecular hydrogen is sourced from PubChem (CID 143310046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).