C17H10O4 — CID 13270680
4-methylpyrano[2,3-a]xanthene-2,12-dione (PubChem CID 13270680) has the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-methylpyrano[2,3-a]xanthene-2,12-dione.
| Compound Name | 4-methylpyrano[2,3-a]xanthene-2,12-dione |
|---|---|
| PubChem CID | 13270680 |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-methylpyrano[2,3-a]xanthene-2,12-dione |
| SMILES | Cc1cc(=O)oc2c1ccc1oc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C17H10O4/c1-9-8-14(18)21-17-10(9)6-7-13-15(17)16(19)11-4-2-3-5-12(11)20-13/h2-8H,1H3 |
| InChIKey | LDCHMIJVYCMTDX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|