C11H14N4O3 — CID 174896620
1,1-diaminourea;4-methylchromen-2-one (PubChem CID 174896620) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1,1-diaminourea;4-methylchromen-2-one.
| Compound Name | 1,1-diaminourea;4-methylchromen-2-one |
|---|---|
| PubChem CID | 174896620 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1,1-diaminourea;4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2ccccc12.NC(=O)N(N)N |
| InChI | InChI=1S/C10H8O2.CH6N4O/c1-7-6-10(11)12-9-5-3-2-4-8(7)9;2-1(6)5(3)4/h2-6H,1H3;3-4H2,(H2,2,6) |
| InChIKey | FOODYLQUQPREEE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|