About 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one
4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one (PubChem CID 25128694) has the molecular formula C16H12O4S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one.
Molecular Properties
| Compound Name | 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one |
| PubChem CID | 25128694 |
| Molecular Formula | C16H12O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one |
| SMILES | Cc1cc(O)c(O)cc1Sc1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C16H12O4S/c1-9-6-11(17)12(18)7-14(9)21-15-8-16(19)20-13-5-3-2-4-10(13)15/h2-8,17-18H,1H3 |
| InChIKey | HQVOGYPBRCVBSV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one?
The IUPAC name of 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one (CID 25128694) is 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one.
What is the SMILES notation for 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one?
The canonical SMILES for 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one is Cc1cc(O)c(O)cc1Sc1cc(=O)oc2ccccc12.
What is the InChIKey of 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one?
The InChIKey is HQVOGYPBRCVBSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4S/c1-9-6-11(17)12(18)7-14(9)21-15-8-16(19)20-13-5-3-2-4-10(13)15/h2-8,17-18H,1H3.
What are the key properties of 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one?
4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one has a molecular weight of 300.34 g/mol, XLogP of 3.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydroxy-2-methylphenyl)sulfanylchromen-2-one is sourced from PubChem (CID 25128694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).