C16H9NO3S — CID 23962876
4-(1,3-benzoxazol-2-ylsulfanyl)chromen-2-one (PubChem CID 23962876) has the molecular formula C16H9NO3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)chromen-2-one.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)chromen-2-one |
|---|---|
| PubChem CID | 23962876 |
| Molecular Formula | C16H9NO3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)chromen-2-one |
| SMILES | O=c1cc(Sc2nc3ccccc3o2)c2ccccc2o1 |
| InChI | InChI=1S/C16H9NO3S/c18-15-9-14(10-5-1-3-7-12(10)19-15)21-16-17-11-6-2-4-8-13(11)20-16/h1-9H |
| InChIKey | PKCVZKAUDDDFAI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|