C14H10N4OS — CID 107491370
6-(1,3-benzoxazol-2-ylsulfanyl)-1H-indazol-5-amine (PubChem CID 107491370) has the molecular formula C14H10N4OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-ylsulfanyl)-1H-indazol-5-amine.
| Compound Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 107491370 |
| Molecular Formula | C14H10N4OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-1H-indazol-5-amine |
| SMILES | Nc1cc2cn[nH]c2cc1Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H10N4OS/c15-9-5-8-7-16-18-11(8)6-13(9)20-14-17-10-3-1-2-4-12(10)19-14/h1-7H,15H2,(H,16,18) |
| InChIKey | DQPVUVKVVVVTSA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|