C10H10N6S — CID 107491518
6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1H-indazol-5-amine (PubChem CID 107491518) has the molecular formula C10H10N6S and a molecular weight of 246.30 g/mol. Its IUPAC name is 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1H-indazol-5-amine.
| Compound Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 107491518 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1H-indazol-5-amine |
| SMILES | Cn1ncnc1Sc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C10H10N6S/c1-16-10(12-5-14-16)17-9-3-8-6(2-7(9)11)4-13-15-8/h2-5H,11H2,1H3,(H,13,15) |
| InChIKey | UUSFEDRZRDNVEC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|