C9H9FN4S — CID 104602805
5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 104602805) has the molecular formula C9H9FN4S and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline.
| Compound Name | 5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 104602805 |
| Molecular Formula | C9H9FN4S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | Cn1ncnc1Sc1ccc(F)cc1N |
| InChI | InChI=1S/C9H9FN4S/c1-14-9(12-5-13-14)15-8-3-2-6(10)4-7(8)11/h2-5H,11H2,1H3 |
| InChIKey | HHQSEHNPNBJDDZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|