C10H10FN5S — CID 104603206
3-fluoro-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 104603206) has the molecular formula C10H10FN5S and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-fluoro-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 104603206 |
| Molecular Formula | C10H10FN5S |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-fluoro-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ncnn2C)c(F)c1 |
| InChI | InChI=1S/C10H10FN5S/c1-16-10(14-5-15-16)17-8-3-2-6(9(12)13)4-7(8)11/h2-5H,1H3,(H3,12,13) |
| InChIKey | MZQDPWRSWOJXNO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|