C9H10N6S — CID 104603204
6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboximidamide (PubChem CID 104603204) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboximidamide.
| Compound Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 104603204 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ncnn2C)nc1 |
| InChI | InChI=1S/C9H10N6S/c1-15-9(13-5-14-15)16-7-3-2-6(4-12-7)8(10)11/h2-5H,1H3,(H3,10,11) |
| InChIKey | ALKQQOSUDICBSL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|