C9H9N5S3 — CID 113298644
6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide (PubChem CID 113298644) has the molecular formula C9H9N5S3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide.
| Compound Name | 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 113298644 |
| Molecular Formula | C9H9N5S3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nnc(SC)s2)nc1 |
| InChI | InChI=1S/C9H9N5S3/c1-15-8-13-14-9(17-8)16-6-3-2-5(4-12-6)7(10)11/h2-4H,1H3,(H3,10,11) |
| InChIKey | OMEXVMQLOAIEOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|