C11H12N4S3 — CID 113298641
4-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 113298641) has the molecular formula C11H12N4S3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 4-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 113298641 |
| Molecular Formula | C11H12N4S3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C)cc1Sc1nnc(SC)s1 |
| InChI | InChI=1S/C11H12N4S3/c1-6-3-4-7(9(12)13)8(5-6)17-11-15-14-10(16-2)18-11/h3-5H,1-2H3,(H3,12,13) |
| InChIKey | WBJXPBYNFULBKP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|