C10H11N3S3 — CID 115382763
5-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline (PubChem CID 115382763) has the molecular formula C10H11N3S3 and a molecular weight of 269.42 g/mol. Its IUPAC name is 5-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline.
| Compound Name | 5-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 115382763 |
| Molecular Formula | C10H11N3S3 |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 5-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
| SMILES | CSc1nnc(Sc2ccc(C)cc2N)s1 |
| InChI | InChI=1S/C10H11N3S3/c1-6-3-4-8(7(11)5-6)15-10-13-12-9(14-2)16-10/h3-5H,11H2,1-2H3 |
| InChIKey | JJHOICOTOHIYPG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|