C11H12N4OS3 — CID 115382787
4-amino-N-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzamide (PubChem CID 115382787) has the molecular formula C11H12N4OS3 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-amino-N-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzamide.
| Compound Name | 4-amino-N-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 115382787 |
| Molecular Formula | C11H12N4OS3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-amino-N-methyl-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzamide |
| SMILES | CNC(=O)c1ccc(N)cc1Sc1nnc(SC)s1 |
| InChI | InChI=1S/C11H12N4OS3/c1-13-9(16)7-4-3-6(12)5-8(7)18-11-15-14-10(17-2)19-11/h3-5H,12H2,1-2H3,(H,13,16) |
| InChIKey | DNKRIHYXMJMJNK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|