C9H9N5OS2 — CID 60874848
N'-hydroxy-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide (PubChem CID 60874848) has the molecular formula C9H9N5OS2 and a molecular weight of 267.34 g/mol. Its IUPAC name is N'-hydroxy-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 60874848 |
| Molecular Formula | C9H9N5OS2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | N'-hydroxy-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
| SMILES | Cc1nnc(Sc2ccc(/C(N)=N/O)cn2)s1 |
| InChI | InChI=1S/C9H9N5OS2/c1-5-12-13-9(16-5)17-7-3-2-6(4-11-7)8(10)14-15/h2-4,15H,1H3,(H2,10,14) |
| InChIKey | CVFORLVEZWVFHU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|