About 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide
6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide (PubChem CID 43615811) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide |
| PubChem CID | 43615811 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide |
| SMILES | CCCCSc1ccc(/C(N)=N/O)cn1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-3-6-15-9-5-4-8(7-12-9)10(11)13-14/h4-5,7,14H,2-3,6H2,1H3,(H2,11,13) |
| InChIKey | LGPFNHNMZJRGQN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide?
The IUPAC name of 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide (CID 43615811) is 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide.
What is the SMILES notation for 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide?
The canonical SMILES for 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide is CCCCSc1ccc(/C(N)=N/O)cn1.
What is the InChIKey of 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide?
The InChIKey is LGPFNHNMZJRGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-2-3-6-15-9-5-4-8(7-12-9)10(11)13-14/h4-5,7,14H,2-3,6H2,1H3,(H2,11,13).
What are the key properties of 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide?
6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide has a molecular weight of 225.32 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylsulfanyl-N'-hydroxypyridine-3-carboximidamide is sourced from PubChem (CID 43615811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).