C9H13N3O2S — CID 77112983
N'-hydroxy-6-(3-hydroxypropylsulfanyl)pyridine-3-carboximidamide (PubChem CID 77112983) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N'-hydroxy-6-(3-hydroxypropylsulfanyl)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-(3-hydroxypropylsulfanyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 77112983 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N'-hydroxy-6-(3-hydroxypropylsulfanyl)pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1ccc(SCCCO)nc1 |
| InChI | InChI=1S/C9H13N3O2S/c10-9(12-14)7-2-3-8(11-6-7)15-5-1-4-13/h2-3,6,13-14H,1,4-5H2,(H2,10,12) |
| InChIKey | FPDBFYKBRXNESH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|