C8H9F2N3O2 — CID 82003968
6-(2,2-difluoroethoxy)-N'-hydroxypyridine-3-carboximidamide (PubChem CID 82003968) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 6-(2,2-difluoroethoxy)-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 82003968 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-N'-hydroxypyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCC(F)F)nc1 |
| InChI | InChI=1S/C8H9F2N3O2/c9-6(10)4-15-7-2-1-5(3-12-7)8(11)13-14/h1-3,6,14H,4H2,(H2,11,13) |
| InChIKey | AFXJEJPBMQRLOG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|