C8H8F2N2OS — CID 82004872
6-(2,2-difluoroethoxy)pyridine-3-carbothioamide (PubChem CID 82004872) has the molecular formula C8H8F2N2OS and a molecular weight of 218.23 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)pyridine-3-carbothioamide.
| Compound Name | 6-(2,2-difluoroethoxy)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 82004872 |
| Molecular Formula | C8H8F2N2OS |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 6-(2,2-difluoroethoxy)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(OCC(F)F)nc1 |
| InChI | InChI=1S/C8H8F2N2OS/c9-6(10)4-13-7-2-1-5(3-12-7)8(11)14/h1-3,6H,4H2,(H2,11,14) |
| InChIKey | XXMBYQLYONDJPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|