C9H10F2N2OS — CID 114768237
2-(2,2-difluoroethoxy)-6-methylpyridine-4-carbothioamide (PubChem CID 114768237) has the molecular formula C9H10F2N2OS and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(2,2-difluoroethoxy)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114768237 |
| Molecular Formula | C9H10F2N2OS |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(OCC(F)F)n1 |
| InChI | InChI=1S/C9H10F2N2OS/c1-5-2-6(9(12)15)3-8(13-5)14-4-7(10)11/h2-3,7H,4H2,1H3,(H2,12,15) |
| InChIKey | OTFKSSLSDGREAY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|