C12H17N3OS — CID 60884933
6-cyclohexylsulfanyl-N'-hydroxypyridine-3-carboximidamide (PubChem CID 60884933) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-cyclohexylsulfanyl-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 6-cyclohexylsulfanyl-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 60884933 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 6-cyclohexylsulfanyl-N'-hydroxypyridine-3-carboximidamide |
| SMILES | N/C(=N\O)c1ccc(SC2CCCCC2)nc1 |
| InChI | InChI=1S/C12H17N3OS/c13-12(15-16)9-6-7-11(14-8-9)17-10-4-2-1-3-5-10/h6-8,10,16H,1-5H2,(H2,13,15) |
| InChIKey | XUPQNNISAJTMSA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|