C6H8N4O — CID 177352508
N'-hydroxy-2-methylpyrimidine-5-carboximidamide (PubChem CID 177352508) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is N'-hydroxy-2-methylpyrimidine-5-carboximidamide.
| Compound Name | N'-hydroxy-2-methylpyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 177352508 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | N'-hydroxy-2-methylpyrimidine-5-carboximidamide |
| SMILES | Cc1ncc(C(N)=NO)cn1 |
| InChI | InChI=1S/C6H8N4O/c1-4-8-2-5(3-9-4)6(7)10-11/h2-3,11H,1H3,(H2,7,10) |
| InChIKey | FNRFOBONZNDGJG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|