C8H10N4O2 — CID 77005050
5-(N'-hydroxycarbamimidoyl)-N-methylpyridine-2-carboxamide (PubChem CID 77005050) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 5-(N'-hydroxycarbamimidoyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 5-(N'-hydroxycarbamimidoyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 77005050 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 5-(N'-hydroxycarbamimidoyl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(C(N)=NO)cn1 |
| InChI | InChI=1S/C8H10N4O2/c1-10-8(13)6-3-2-5(4-11-6)7(9)12-14/h2-4,14H,1H3,(H2,9,12)(H,10,13) |
| InChIKey | KQIGPNWTVZRSJR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|