C11H16N4O2S — CID 113472987
5-[(Z)-N'-hydroxycarbamimidoyl]-N-(1-methylsulfanylpropan-2-yl)pyridine-2-carboxamide (PubChem CID 113472987) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-[(Z)-N'-hydroxycarbamimidoyl]-N-(1-methylsulfanylpropan-2-yl)pyridine-2-carboxamide.
| Compound Name | 5-[(Z)-N'-hydroxycarbamimidoyl]-N-(1-methylsulfanylpropan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113472987 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-[(Z)-N'-hydroxycarbamimidoyl]-N-(1-methylsulfanylpropan-2-yl)pyridine-2-carboxamide |
| SMILES | CSCC(C)NC(=O)c1ccc(/C(N)=N/O)cn1 |
| InChI | InChI=1S/C11H16N4O2S/c1-7(6-18-2)14-11(16)9-4-3-8(5-13-9)10(12)15-17/h3-5,7,17H,6H2,1-2H3,(H2,12,15)(H,14,16) |
| InChIKey | LCHKTINXNPINHJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|