C10H13N7S — CID 104603193
5,6-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazine-4-carboximidamide (PubChem CID 104603193) has the molecular formula C10H13N7S and a molecular weight of 263.33 g/mol. Its IUPAC name is 5,6-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazine-4-carboximidamide.
| Compound Name | 5,6-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 104603193 |
| Molecular Formula | C10H13N7S |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 5,6-dimethyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(Sc2ncnn2C)nnc(C)c1C |
| InChI | InChI=1S/C10H13N7S/c1-5-6(2)15-16-9(7(5)8(11)12)18-10-13-4-14-17(10)3/h4H,1-3H3,(H3,11,12) |
| InChIKey | AMOBVAFCIKMMBY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|