C6H11N5S — CID 104603220
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanimidamide (PubChem CID 104603220) has the molecular formula C6H11N5S and a molecular weight of 185.26 g/mol. Its IUPAC name is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanimidamide.
| Compound Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanimidamide |
|---|---|
| PubChem CID | 104603220 |
| Molecular Formula | C6H11N5S |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanimidamide |
| SMILES | [H]/N=C(\N)CCSc1ncnn1C |
| InChI | InChI=1S/C6H11N5S/c1-11-6(9-4-10-11)12-3-2-5(7)8/h4H,2-3H2,1H3,(H3,7,8) |
| InChIKey | MWYQFEMAXOGJSP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|