C13H17FN4OS — CID 104604291
N-[[5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine (PubChem CID 104604291) has the molecular formula C13H17FN4OS and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[[5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 104604291 |
| Molecular Formula | C13H17FN4OS |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[[5-fluoro-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)ccc1Sc1ncnn1C |
| InChI | InChI=1S/C13H17FN4OS/c1-18-13(16-9-17-18)20-12-4-3-11(14)7-10(12)8-15-5-6-19-2/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | VXZUDJVWFOXFRX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|