C15H24FNO2S — CID 107696885
N-[[2-(3-ethylsulfanylpropoxy)-5-fluorophenyl]methyl]-2-methoxyethanamine (PubChem CID 107696885) has the molecular formula C15H24FNO2S and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[[2-(3-ethylsulfanylpropoxy)-5-fluorophenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(3-ethylsulfanylpropoxy)-5-fluorophenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107696885 |
| Molecular Formula | C15H24FNO2S |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[[2-(3-ethylsulfanylpropoxy)-5-fluorophenyl]methyl]-2-methoxyethanamine |
| SMILES | CCSCCCOc1ccc(F)cc1CNCCOC |
| InChI | InChI=1S/C15H24FNO2S/c1-3-20-10-4-8-19-15-6-5-14(16)11-13(15)12-17-7-9-18-2/h5-6,11,17H,3-4,7-10,12H2,1-2H3 |
| InChIKey | YWTGFZZVWNNMMM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|