C15H18FNO2S — CID 107697144
N-[[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 107697144) has the molecular formula C15H18FNO2S and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107697144 |
| Molecular Formula | C15H18FNO2S |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)ccc1OCc1ccsc1 |
| InChI | InChI=1S/C15H18FNO2S/c1-18-6-5-17-9-13-8-14(16)2-3-15(13)19-10-12-4-7-20-11-12/h2-4,7-8,11,17H,5-6,9-10H2,1H3 |
| InChIKey | QVFSFIQFXFUMBV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|