C13H20FNO4S — CID 107696997
N-[[5-fluoro-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 107696997) has the molecular formula C13H20FNO4S and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[[5-fluoro-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-fluoro-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107696997 |
| Molecular Formula | C13H20FNO4S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[[5-fluoro-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)ccc1OCCS(C)(=O)=O |
| InChI | InChI=1S/C13H20FNO4S/c1-18-6-5-15-10-11-9-12(14)3-4-13(11)19-7-8-20(2,16)17/h3-4,9,15H,5-8,10H2,1-2H3 |
| InChIKey | ILZLCIYOIPMJKD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|