C15H22FNO4 — CID 107697006
3-[4-fluoro-2-[(2-methoxyethylamino)methyl]phenoxy]-2,2-dimethylpropanoic acid (PubChem CID 107697006) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is 3-[4-fluoro-2-[(2-methoxyethylamino)methyl]phenoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-fluoro-2-[(2-methoxyethylamino)methyl]phenoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 107697006 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-[4-fluoro-2-[(2-methoxyethylamino)methyl]phenoxy]-2,2-dimethylpropanoic acid |
| SMILES | COCCNCc1cc(F)ccc1OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H22FNO4/c1-15(2,14(18)19)10-21-13-5-4-12(16)8-11(13)9-17-6-7-20-3/h4-5,8,17H,6-7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | SVERWBMPCOYWPT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|