C13H18FN5O2 — CID 107696935
N-[[5-fluoro-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]methyl]-2-methoxyethanamine (PubChem CID 107696935) has the molecular formula C13H18FN5O2 and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[[5-fluoro-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-fluoro-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107696935 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[[5-fluoro-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(F)ccc1OCc1nnn(C)n1 |
| InChI | InChI=1S/C13H18FN5O2/c1-19-17-13(16-18-19)9-21-12-4-3-11(14)7-10(12)8-15-5-6-20-2/h3-4,7,15H,5-6,8-9H2,1-2H3 |
| InChIKey | HFGNCZRXFCGWIL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|