C11H8N4OS — CID 116798176
2-(1,3-benzoxazol-2-ylsulfanyl)pyrimidin-4-amine (PubChem CID 116798176) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116798176 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(Sc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C11H8N4OS/c12-9-5-6-13-10(15-9)17-11-14-7-3-1-2-4-8(7)16-11/h1-6H,(H2,12,13,15) |
| InChIKey | URMLYSVTJRWBJD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |