C11H7N5O3S — CID 3564117
6-(1,3-benzoxazol-2-ylsulfanyl)-5-nitropyrimidin-4-amine (PubChem CID 3564117) has the molecular formula C11H7N5O3S and a molecular weight of 289.28 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-ylsulfanyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3564117 |
| Molecular Formula | C11H7N5O3S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-5-nitropyrimidin-4-amine |
| SMILES | Nc1ncnc(Sc2nc3ccccc3o2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7N5O3S/c12-9-8(16(17)18)10(14-5-13-9)20-11-15-6-3-1-2-4-7(6)19-11/h1-5H,(H2,12,13,14) |
| InChIKey | PVEICEYUDIGUIW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|