C13H11N3O3S2 — CID 60987266
3-amino-5-(1,3-benzoxazol-2-ylsulfanyl)benzenesulfonamide (PubChem CID 60987266) has the molecular formula C13H11N3O3S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-amino-5-(1,3-benzoxazol-2-ylsulfanyl)benzenesulfonamide.
| Compound Name | 3-amino-5-(1,3-benzoxazol-2-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60987266 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-amino-5-(1,3-benzoxazol-2-ylsulfanyl)benzenesulfonamide |
| SMILES | Nc1cc(Sc2nc3ccccc3o2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H11N3O3S2/c14-8-5-9(7-10(6-8)21(15,17)18)20-13-16-11-3-1-2-4-12(11)19-13/h1-7H,14H2,(H2,15,17,18) |
| InChIKey | JKTMGADBIZFSOM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|