C14H7FN2OS — CID 102818368
3-(1,3-benzoxazol-2-ylsulfanyl)-5-fluorobenzonitrile (PubChem CID 102818368) has the molecular formula C14H7FN2OS and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-5-fluorobenzonitrile.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102818368 |
| Molecular Formula | C14H7FN2OS |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(Sc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C14H7FN2OS/c15-10-5-9(8-16)6-11(7-10)19-14-17-12-3-1-2-4-13(12)18-14/h1-7H |
| InChIKey | IQLXACZDJJSINC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |