C15H12FNO2S — CID 78951937
(1S)-1-[4-(1,3-benzoxazol-2-ylsulfanyl)-3-fluorophenyl]ethanol (PubChem CID 78951937) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S)-1-[4-(1,3-benzoxazol-2-ylsulfanyl)-3-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[4-(1,3-benzoxazol-2-ylsulfanyl)-3-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 78951937 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (1S)-1-[4-(1,3-benzoxazol-2-ylsulfanyl)-3-fluorophenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(Sc2nc3ccccc3o2)c(F)c1 |
| InChI | InChI=1S/C15H12FNO2S/c1-9(18)10-6-7-14(11(16)8-10)20-15-17-12-4-2-3-5-13(12)19-15/h2-9,18H,1H3/t9-/m0/s1 |
| InChIKey | YSQCUVIFOPYXJZ-VIFPVBQESA-N |
| XLogP | 4.17 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |