C11H10N4OS — CID 55011762
4-(1,3-benzoxazol-2-ylsulfanyl)-2-methyl-1H-imidazol-5-amine (PubChem CID 55011762) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methyl-1H-imidazol-5-amine.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methyl-1H-imidazol-5-amine |
|---|---|
| PubChem CID | 55011762 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-2-methyl-1H-imidazol-5-amine |
| SMILES | Cc1nc(Sc2nc3ccccc3o2)c(N)[nH]1 |
| InChI | InChI=1S/C11H10N4OS/c1-6-13-9(12)10(14-6)17-11-15-7-4-2-3-5-8(7)16-11/h2-5H,12H2,1H3,(H,13,14) |
| InChIKey | SOTFZKGREZNUQJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |