C13H12N4OS — CID 80893922
4-(1,3-benzoxazol-2-ylsulfanyl)-N,6-dimethylpyrimidin-2-amine (PubChem CID 80893922) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-N,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-N,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80893922 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-N,6-dimethylpyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(Sc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C13H12N4OS/c1-8-7-11(17-12(14-2)15-8)19-13-16-9-5-3-4-6-10(9)18-13/h3-7H,1-2H3,(H,14,15,17) |
| InChIKey | USLWFHSETNCFSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |