C13H12N4OS — CID 80893597
6-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpyrazin-2-amine (PubChem CID 80893597) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpyrazin-2-amine.
| Compound Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpyrazin-2-amine |
|---|---|
| PubChem CID | 80893597 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 6-(1,3-benzoxazol-2-ylsulfanyl)-N-ethylpyrazin-2-amine |
| SMILES | CCNc1cncc(Sc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C13H12N4OS/c1-2-15-11-7-14-8-12(17-11)19-13-16-9-5-3-4-6-10(9)18-13/h3-8H,2H2,1H3,(H,15,17) |
| InChIKey | DMYPMXTUYWKWNN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |