C11H8N4O — CID 67388669
3-(1,3-benzoxazol-2-yl)pyrazin-2-amine (PubChem CID 67388669) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)pyrazin-2-amine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 67388669 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H8N4O/c12-10-9(13-5-6-14-10)11-15-7-3-1-2-4-8(7)16-11/h1-6H,(H2,12,14) |
| InChIKey | HJGIOFGHABSJAB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |