About 2-(1H-indazol-3-yl)-1,3-benzoxazole
2-(1H-indazol-3-yl)-1,3-benzoxazole (PubChem CID 66524515) has the molecular formula C14H9N3O
and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-(1H-indazol-3-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(1H-indazol-3-yl)-1,3-benzoxazole |
| PubChem CID | 66524515 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-(1H-indazol-3-yl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3n[nH]c4ccccc34)nc2c1 |
| InChI | InChI=1S/C14H9N3O/c1-2-6-10-9(5-1)13(17-16-10)14-15-11-7-3-4-8-12(11)18-14/h1-8H,(H,16,17) |
| InChIKey | WSMXZANZRGURJR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indazol-3-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indazol-3-yl)-1,3-benzoxazole?
The IUPAC name of 2-(1H-indazol-3-yl)-1,3-benzoxazole (CID 66524515) is 2-(1H-indazol-3-yl)-1,3-benzoxazole.
What is the SMILES notation for 2-(1H-indazol-3-yl)-1,3-benzoxazole?
The canonical SMILES for 2-(1H-indazol-3-yl)-1,3-benzoxazole is c1ccc2oc(-c3n[nH]c4ccccc34)nc2c1.
What is the InChIKey of 2-(1H-indazol-3-yl)-1,3-benzoxazole?
The InChIKey is WSMXZANZRGURJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O/c1-2-6-10-9(5-1)13(17-16-10)14-15-11-7-3-4-8-12(11)18-14/h1-8H,(H,16,17).
What are the key properties of 2-(1H-indazol-3-yl)-1,3-benzoxazole?
2-(1H-indazol-3-yl)-1,3-benzoxazole has a molecular weight of 235.25 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indazol-3-yl)-1,3-benzoxazole is sourced from PubChem (CID 66524515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).