C19H16N4O3S — CID 67388957
3-(1,3-benzoxazol-2-yl)-5-(3-ethylsulfonylphenyl)pyrazin-2-amine (PubChem CID 67388957) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-5-(3-ethylsulfonylphenyl)pyrazin-2-amine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-5-(3-ethylsulfonylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 67388957 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-5-(3-ethylsulfonylphenyl)pyrazin-2-amine |
| SMILES | CCS(=O)(=O)c1cccc(-c2cnc(N)c(-c3nc4ccccc4o3)n2)c1 |
| InChI | InChI=1S/C19H16N4O3S/c1-2-27(24,25)13-7-5-6-12(10-13)15-11-21-18(20)17(22-15)19-23-14-8-3-4-9-16(14)26-19/h3-11H,2H2,1H3,(H2,20,21) |
| InChIKey | HKROFAAMYWOISO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |