C10H9IN4O2S — CID 118002712
3-(5-amino-6-iodopyrazin-2-yl)benzenesulfonamide (PubChem CID 118002712) has the molecular formula C10H9IN4O2S and a molecular weight of 376.18 g/mol. Its IUPAC name is 3-(5-amino-6-iodopyrazin-2-yl)benzenesulfonamide.
| Compound Name | 3-(5-amino-6-iodopyrazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118002712 |
| Molecular Formula | C10H9IN4O2S |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 3-(5-amino-6-iodopyrazin-2-yl)benzenesulfonamide |
| SMILES | Nc1ncc(-c2cccc(S(N)(=O)=O)c2)nc1I |
| InChI | InChI=1S/C10H9IN4O2S/c11-9-10(12)14-5-8(15-9)6-2-1-3-7(4-6)18(13,16)17/h1-5H,(H2,12,14)(H2,13,16,17) |
| InChIKey | GEJUMWCMGPPNRH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|