C17H15N5O3S — CID 71080374
2-amino-N-pyridin-4-yl-5-(3-sulfamoylphenyl)pyridine-3-carboxamide (PubChem CID 71080374) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-amino-N-pyridin-4-yl-5-(3-sulfamoylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-pyridin-4-yl-5-(3-sulfamoylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71080374 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-amino-N-pyridin-4-yl-5-(3-sulfamoylphenyl)pyridine-3-carboxamide |
| SMILES | Nc1ncc(-c2cccc(S(N)(=O)=O)c2)cc1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C17H15N5O3S/c18-16-15(17(23)22-13-4-6-20-7-5-13)9-12(10-21-16)11-2-1-3-14(8-11)26(19,24)25/h1-10H,(H2,18,21)(H2,19,24,25)(H,20,22,23) |
| InChIKey | XIXUGUKTZKBHOE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |