C19H15FN4O3 — CID 71060843
methyl 4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]-2-fluorobenzoate (PubChem CID 71060843) has the molecular formula C19H15FN4O3 and a molecular weight of 366.35 g/mol. Its IUPAC name is methyl 4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 71060843 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2cnc(N)c(C(=O)Nc3ccncc3)c2)cc1F |
| InChI | InChI=1S/C19H15FN4O3/c1-27-19(26)14-3-2-11(9-16(14)20)12-8-15(17(21)23-10-12)18(25)24-13-4-6-22-7-5-13/h2-10H,1H3,(H2,21,23)(H,22,24,25) |
| InChIKey | QMZHLDPYLWPXNH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |