C26H29N5O4 — CID 159902780
tert-butyl N-[4-[4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl]-4-oxobutyl]carbamate (PubChem CID 159902780) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 159902780 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | tert-butyl N-[4-[4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)c1ccc(-c2cnc(N)c(C(=O)Nc3ccncc3)c2)cc1 |
| InChI | InChI=1S/C26H29N5O4/c1-26(2,3)35-25(34)29-12-4-5-22(32)18-8-6-17(7-9-18)19-15-21(23(27)30-16-19)24(33)31-20-10-13-28-14-11-20/h6-11,13-16H,4-5,12H2,1-3H3,(H2,27,30)(H,29,34)(H,28,31,33) |
| InChIKey | NWEFSOURRLKVIV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|